| Product Name | antineoplaston AS 2-1 |
| CAS No. | 104624-98-8 |
| Synonyms | Antineoplaston AS 2-1; Benzeneacetic acid, sodium salt, mixt. with N2-(phenylacetyl)-L-glutamine monosodium salt; Antineoplaston AS2-1; L-Glutamine, N2-(phenylacetyl)-, monosodium salt, mixt. with sodium benzeneacetate; sodium (2S)-5-amino-5-oxo-2-[(phenylacetyl)amino]pentanoate phenylacetate (2:1:1) |
| InChI | InChI=1/C13H16N2O4.C8H8O2.2Na/c14-11(16)7-6-10(13(18)19)15-12(17)8-9-4-2-1-3-5-9;9-8(10)6-7-4-2-1-3-5-7;;/h1-5,10H,6-8H2,(H2,14,16)(H,15,17)(H,18,19);1-5H,6H2,(H,9,10);;/q;;2*+1/p-2/t10-;;;/m0.../s1 |
| Molecular Formula | C21H22N2Na2O6 |
| Molecular Weight | 444.3887 |
| Boiling point | 655.5°C at 760 mmHg |
| Flash point | 350.2°C |
104624-98-8 antineoplaston as 2-1
service@apichina.com