| Product Name | Amyl crotonate |
| CAS No. | 2998-23-4 |
| Synonyms | n-Amyl acrylate, (Acrylic acid n-amyl ester); n-Amyl Acrylate; Acrylic acid n-pentyl ester~n-Amyl acrylate; pentyl prop-2-enoate |
| InChI | InChI=1/C8H14O2/c1-3-5-6-7-10-8(9)4-2/h4H,2-3,5-7H2,1H3 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.1956 |
| Density | 0.893g/cm3 |
| Boiling point | 169.4°C at 760 mmHg |
| Flash point | 48.2°C |
| Refractive index | 1.423 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; |
2998-23-4 amyl crotonate
service@apichina.com