| Product Name | Amines, N-(C14-18 and C16-18-unsatd. alkyl)trimethylenedi- |
| CAS No. | 68439-73-6 |
| Synonyms | Tallow trimethylene diamine; Tallowaminopropylamine; (C14-C18 and (C16-C18 Unsaturated N-(alkyl)propylenediamine; N-(C14-18 and C16-18-unsatd.-alkyl)trimethylenediamines; N-(C14-C18) and (C16-C18) Unsaturated alkylpropylenediamine; N-(C14-C18) and (C16-C18)Unsaturated alkyl propylenediamine; SDA 04-032-00; Amines, N-(C14-18 and C16-18-unsatd. alkyl)trimethylenedi- |
| InChI | InChI=1/C20H43N/c1-4-7-8-9-10-11-12-13-14-15-16-17-20-21(18-5-2)19-6-3/h4-20H2,1-3H3 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.567 |
68439-73-6 amines, n-(c14-18 and c16-18-unsatd. alkyl)trimethylenedi-
service@apichina.com