| Product Name | (-)-alpha-Pinene oxide |
| CAS No. | 19894-99-6 |
| Synonyms | (1R,2R,3S,5R)-(-)-2,3-Epoxypinane; [1R-(1α,2β,4β,6α)]-2,2,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane; (1R,2R,4S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane |
| InChI | InChI=1/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3/t6-,7-,8+,10-/m1/s1 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.2334 |
| Density | 1.027g/cm3 |
| Boiling point | 188.6°C at 760 mmHg |
| Flash point | 65.6°C |
| Refractive index | 1.504 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R37/38:Irritating to respiratory system and skin.; R41:Risks of serious damage to eyes.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
19894-99-6 (-)-alpha-pinene oxide
service@apichina.com