| Product Name | alpha-(Phenylthio)phenylacetic acid |
| CAS No. | 10490-07-0 |
| Synonyms | benzeneacetic acid, alpha-(phenylthio)-; Phenyl(phenylsulfanyl)acetic acid |
| InChI | InChI=1/C14H12O2S/c15-14(16)13(11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.3089 |
| Density | 1.26g/cm3 |
| Boiling point | 390.6°C at 760 mmHg |
| Flash point | 190°C |
| Refractive index | 1.651 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
10490-07-0 alpha-(phenylthio)phenylacetic acid
service@apichina.com