| Product Name | alpha-Naphthyl Red hydrochloride |
| CAS No. | 83833-14-1 |
| Synonyms | C.I. 11350~4-Phenylazo-1-naphthylamine~Solvent Yellow 4; 4-[(E)-phenyldiazenyl]naphthalen-1-amine hydrochloride |
| InChI | InChI=1/C16H13N3.ClH/c17-15-10-11-16(14-9-5-4-8-13(14)15)19-18-12-6-2-1-3-7-12;/h1-11H,17H2;1H/b19-18+; |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.7555 |
| Boiling point | 451.4°C at 760 mmHg |
| Flash point | 226.8°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
83833-14-1 alpha-naphthyl red hydrochloride
service@apichina.com