| Product Name | Alpha-Naphthoflavone |
| CAS No. | 604-59-1 |
| Synonyms | 7,8-Benzoflavone; 2-phenylbenzo(h)chromen-4-one; 2-phenyl-4H-benzo[h]chromen-4-one |
| InChI | InChI=1/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
| Molecular Formula | C19H12O2 |
| Molecular Weight | 272.2974 |
| Density | 1.276g/cm3 |
| Melting point | 155-157℃ |
| Boiling point | 460.9°C at 760 mmHg |
| Flash point | 215.8°C |
| Refractive index | 1.695 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
604-59-1 alpha-naphthoflavone
service@apichina.com
- Next:604-61-5 ethyl 2-benzoylbenzoate
- Previous:604-58-0 equilenin benzoate