| Product Name | alpha-Methylbenzyl cyanide |
| CAS No. | 1823-91-2 |
| Synonyms | alpha-Methylphenylacetonitrile; 2-Phenylpropionitrile; 2-phenylpropiononitrile; hydratroponitrile; 2-Phenylpropionitrile (Alpha-); α-Methylphenylacetonitrile; 2-phenylpropanenitrile; (2S)-2-phenylpropanenitrile; (2R)-2-phenylpropanenitrile; 2-(o-tolyl)acetonitrile; 2-methylbenzeneacetonitrile; 2-Phenyl propionitrile |
| InChI | InChI=1/C9H9N/c1-8-4-2-3-5-9(8)6-7-10/h2-5H,6H2,1H3 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.1745 |
| Density | 0.994g/cm3 |
| Boiling point | 244°C at 760 mmHg |
| Flash point | 111.3°C |
| Refractive index | 1.526 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
1823-91-2 alpha-methylbenzyl cyanide
service@apichina.com