| Product Name | alpha-(methylaminomethyl)benzyl alcohol |
| CAS No. | 6589-55-5 |
| Synonyms | Halostachine~2-(Methylamino)-1-phenylethanol; 2-(methylamino)-1-phenylethanol; 2-hydroxy-N-methyl-2-phenylethanaminium chloride |
| InChI | InChI=1/C9H13NO.ClH/c1-10-7-9(11)8-5-3-2-4-6-8;/h2-6,9-11H,7H2,1H3;1H |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.6666 |
| Melting point | 74-76℃ |
| Boiling point | 244.1°C at 760 mmHg |
| Flash point | 96.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6589-55-5 alpha-(methylaminomethyl)benzyl alcohol
service@apichina.com