| Product Name | alpha-Isopropylphenylacetic acid |
| CAS No. | 3508-94-9 |
| Synonyms | 3-Methyl-2-phenylbutyric acid; 3-methyl-2-phenylbutanoic acid; (2S)-3-methyl-2-phenylbutanoate |
| InChI | InChI=1/C11H14O2/c1-8(2)10(11(12)13)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,13)/p-1/t10-/m0/s1 |
| Molecular Formula | C11H13O2 |
| Molecular Weight | 177.2203 |
| Boiling point | 282°C at 760 mmHg |
| Flash point | 179.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3508-94-9 alpha-isopropylphenylacetic acid
service@apichina.com