| Product Name | Alpha-Fluorocinnamic acid |
| CAS No. | 350-90-3 |
| Synonyms | Cinnamic acid, alpha-fluoro-; 1-09-00-00237 (Beilstein Handbook Reference); 2-Fluoro-3-phenyl-2-propenoic acid; BRN 2501318; NSC 102780; alpha-Fluorocinnamic acid; 2-Propenoic acid, 2-fluoro-3-phenyl- (9CI); 2-fluoro-3-phenylprop-2-enoic acid; (2Z)-2-fluoro-3-phenylprop-2-enoate; (2Z)-2-fluoro-3-phenylprop-2-enoic acid |
| InChI | InChI=1/C9H7FO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6H,(H,11,12)/b8-6- |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.1491 |
| Density | 1.275g/cm3 |
| Melting point | 156-160℃ |
| Boiling point | 289.3°C at 760 mmHg |
| Flash point | 128.7°C |
| Refractive index | 1.585 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
350-90-3 alpha-fluorocinnamic acid
service@apichina.com