| Product Name | alpha-Ethyl-3-hydroxy-4-methylphenethylaminehydrochloride |
| CAS No. | 29440-91-3 |
| Synonyms | 5-(2-Aminobutyl)o-cresol hydrochloride; 5-(2-Aminobutyl)o-cresol HCl; 5-(2-aminobutyl)-2-methylphenol; 5-(2-aminobutyl)-2-methylphenol hydrochloride; (2S)-1-(3-hydroxy-4-methylphenyl)butan-2-aminium; (2R)-1-(3-hydroxy-4-methylphenyl)butan-2-aminium |
| InChI | InChI=1/C11H17NO/c1-3-10(12)6-9-5-4-8(2)11(13)7-9/h4-5,7,10,13H,3,6,12H2,1-2H3/p+1/t10-/m1/s1 |
| Molecular Formula | C11H18NO |
| Molecular Weight | 180.2662 |
| Melting point | 158-160℃ |
| Boiling point | 306.9°C at 760 mmHg |
| Flash point | 139.4°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
29440-91-3 alpha-ethyl-3-hydroxy-4-methylphenethylaminehydrochloride
service@apichina.com