| Product Name | alpha-cyanocinnamic acid |
| CAS No. | 1011-92-3 |
| Synonyms | Cyanocinnamicacid; (2E)-2-cyano-3-phenylprop-2-enoic acid; (2Z)-2-cyano-3-phenylprop-2-enoic acid; (2E)-2-cyano-3-phenylprop-2-enoate |
| InChI | InChI=1/C10H7NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-6H,(H,12,13)/p-1/b9-6+ |
| Molecular Formula | C10H6NO2 |
| Molecular Weight | 172.1607 |
| Boiling point | 337.9°C at 760 mmHg |
| Flash point | 158.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1011-92-3 alpha-cyanocinnamic acid
service@apichina.com