| Product Name | alpha-Cyano-o-tolunitrile |
| CAS No. | 3759-28-2 |
| Synonyms | a-Cyano-o-tolunitrile; alpha-cyano-ortho-tolunitrile; alpha,o-toluenedicarbonitrile; 2-Cyanophenylacetonitrile; 2-(cyanomethyl)benzonitrile; 2-Cyanobenzyl cyanide |
| InChI | InChI=1/C9H6N2/c10-6-5-8-3-1-2-4-9(8)7-11/h1-4H,5H2 |
| Molecular Formula | C9H6N2 |
| Molecular Weight | 142.1573 |
| Density | 1.12g/cm3 |
| Melting point | 76℃ |
| Boiling point | 293.8°C at 760 mmHg |
| Flash point | 140.7°C |
| Refractive index | 1.553 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28A:After contact with skin, wash immediately with plenty of water.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3759-28-2 alpha-cyano-o-tolunitrile
service@apichina.com