| Product Name | Alpha-Cyano-4-hydroxycinnamic acid |
| CAS No. | 28166-41-8 |
| Synonyms | alpha-Cyano-4-hydroxycinnamate; NSC 173138; 2-Cyano-3-(4-hydroxyphenyl)acrylic acid; 2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid; (2E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid; (2E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate |
| InChI | InChI=1/C10H7NO3/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h1-5,12H,(H,13,14)/p-1/b8-5+ |
| Molecular Formula | C10H6NO3 |
| Molecular Weight | 188.1601 |
| Melting point | 250-253℃ |
| Boiling point | 398.1°C at 760 mmHg |
| Flash point | 194.5°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
28166-41-8 alpha-cyano-4-hydroxycinnamic acid
service@apichina.com