| Product Name | alpha-Bromo-4-(diethylamino)acetophenone |
| CAS No. | 207986-25-2 |
| Synonyms | 4-(Diethylamino)phenacyl bromide; 2-bromo-1-[4-(diethylamino)phenyl]ethanone |
| InChI | InChI=1/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.1655 |
| Density | 1.316g/cm3 |
| Boiling point | 357.7°C at 760 mmHg |
| Flash point | 170.1°C |
| Refractive index | 1.572 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
207986-25-2 alpha-bromo-4-(diethylamino)acetophenone
service@apichina.com