| Product Name | alpha-Bromo-4-(1-pyrrolidino)acetophenone |
| CAS No. | 216144-18-2 |
| Synonyms | 4-(1-Pyrrolidino)phenacyl bromide; 2-bromo-1-(4-pyrrolidin-1-ylphenyl)ethanone |
| InChI | InChI=1/C12H14BrNO/c13-9-12(15)10-3-5-11(6-4-10)14-7-1-2-8-14/h3-6H,1-2,7-9H2 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.1497 |
| Density | 1.421g/cm3 |
| Boiling point | 386.6°C at 760 mmHg |
| Flash point | 187.6°C |
| Refractive index | 1.596 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
216144-18-2 alpha-bromo-4-(1-pyrrolidino)acetophenone
service@apichina.com