| Sales Email | Service@apichina.com |
| CAS No. | 441-38-3 |
| Product Name | alpha-Benzoin oxime |
| Synonyms | 2-Hydroxy-1,2-diphenylethanone oxime (alpha-form); a-Benzoin oxime, (Cupron); (1E)-2-hydroxy-1,2-diphenylethanone oxime; (1Z)-2-hydroxy-1,2-diphenylethanone oxime; (1Z,2S)-2-hydroxy-1,2-diphenylethanone oxime; (1E,2S)-2-hydroxy-1,2-diphenylethanone oxime; (1Z,2R)-2-hydroxy-1,2-diphenylethanone oxime; α-Benzoin oxime; Benzoin α-oxime |
| InChI | InChI=1/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13-/t14-/m1/s1 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.2585 |
| Density | 1.13g/cm3 |
| Melting point | 150-155℃ |
| Boiling point | 417.8°C at 760 mmHg |
| Flash point | 270.4°C |
| Refractive index | 1.58 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
