| Product Name | alpha,alpha,4-Tribromoacetophenone |
| CAS No. | 13195-79-4 |
| Synonyms | Acetophenone, 2,2,4'-tribromo-; 2,2,4'-Tribromoacetophenone; 2,2-Dibromo-1-(4-bromophenyl)ethanone; 3-07-00-00987 (Beilstein Handbook Reference); 4,alpha,alpha-Tribromoacetophenone; 4alpha,alpha-Tribromoacetophenone; BRN 1949157; NSC 78440; 2,2-Dibromo-1-(4-bromophenyl)ethan-1-one; Ethanone, 2,2-dibromo-1-(4-bromophenyl)- (9CI); 3-amino-2-methylquinazolin-4(3H)-one |
| InChI | InChI=1/C9H9N3O/c1-6-11-8-5-3-2-4-7(8)9(13)12(6)10/h2-5H,10H2,1H3 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.1873 |
| Density | 1.35g/cm3 |
| Boiling point | 348.1°C at 760 mmHg |
| Flash point | 164.4°C |
| Refractive index | 1.675 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
13195-79-4 alpha,alpha,4-tribromoacetophenone
service@apichina.com