| Product Name | alpha-Acetamido-2-methylcinnamic acid |
| CAS No. | 88681-64-5 |
| Synonyms | (2Z)-2-(acetylamino)-3-(2-methylphenyl)prop-2-enoic acid |
| InChI | InChI=1/C12H13NO3/c1-8-5-3-4-6-10(8)7-11(12(15)16)13-9(2)14/h3-7H,1-2H3,(H,13,14)(H,15,16)/b11-7- |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.2365 |
| Density | 1.217g/cm3 |
| Boiling point | 456.6°C at 760 mmHg |
| Flash point | 230°C |
| Refractive index | 1.595 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
88681-64-5 alpha-acetamido-2-methylcinnamic acid
service@apichina.com