| Product Name | Allylurea |
| CAS No. | 557-11-9 |
| Synonyms | 2-Propenylurea; 1-Allylurea; 4-04-00-01070 (Beilstein Handbook Reference); AI3-23204; Allyl urea; Allylcarbamide; BRN 1745068; CCRIS 5958; Monoallylurea; N-2-Propenylurea; N-Allylurea; NSC 7607; Urea, 2-propenyl-; Urea, N-2-propen-1-yl-; Urea, allyl-; 1-prop-2-en-1-ylurea |
| InChI | InChI=1/C4H8N2O/c1-2-3-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.1191 |
| Density | 1.008g/cm3 |
| Melting point | 80-85℃ |
| Boiling point | 167.9°C at 760 mmHg |
| Flash point | 55.3°C |
| Refractive index | 1.465 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
557-11-9 allylurea
service@apichina.com