| Product Name | Allylidenediacetate |
| CAS No. | 869-29-4 |
| Synonyms | 212-789-0; prop-1-ene-3,3-diyl diacetate |
| InChI | InChI=1/C7H10O4/c1-4-7(10-5(2)8)11-6(3)9/h4,7H,1H2,2-3H3 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.1519 |
| Density | 1.079g/cm3 |
| Boiling point | 180°C at 760 mmHg |
| Flash point | 78.3°C |
| Refractive index | 1.428 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
869-29-4 allylidenediacetate
service@apichina.com