| Product Name | Allyl isopropyl sulphide |
| CAS No. | 50996-72-0 |
| Synonyms | Allyl iso-Propyl Sulfide; 3-(propan-2-ylsulfanyl)prop-1-ene |
| InChI | InChI=1/C6H12S/c1-4-5-7-6(2)3/h4,6H,1,5H2,2-3H3 |
| Molecular Formula | C6H12S |
| Molecular Weight | 116.2245 |
| Density | 0.848g/cm3 |
| Boiling point | 134.4°C at 760 mmHg |
| Flash point | 25.5°C |
| Refractive index | 1.46 |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
50996-72-0 allyl isopropyl sulphide
service@apichina.com