| Product Name | Allyl crotonate |
| CAS No. | 20474-93-5 |
| Synonyms | Crotonic acid allyl ester; prop-2-en-1-yl but-2-enoate; prop-2-en-1-yl (2E)-but-2-enoate |
| InChI | InChI=1/C7H10O2/c1-3-5-7(8)9-6-4-2/h3-5H,2,6H2,1H3/b5-3+ |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.1531 |
| Density | 0.925g/cm3 |
| Boiling point | 151.3°C at 760 mmHg |
| Flash point | 50.7°C |
| Refractive index | 1.441 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
20474-93-5 allyl crotonate
service@apichina.com