| Product Name | adipic acid, compound with 1,4-bis(3-aminopropyl)piperazine (1:1) |
| CAS No. | 5423-61-0 |
| Synonyms | Hexanedioic acid, compd. with 1,4-piperazinedipropanamine (1:1); 1,4-Bis(3-aminopropyl)piperazine adipate (1:1); NSC 13218; Adipic acid, compd. with 1,4-bis(3-aminopropyl)piperazine (1:1) (8CI); Adipic acid, compound with 1,4-bis(3-aminopropyl)piperazine (1:1); hexanedioic acid - 3,3'-piperazine-1,4-diyldipropan-1-amine (1:1) |
| InChI | InChI=1/C10H24N4.C6H10O4/c11-3-1-5-13-7-9-14(10-8-13)6-2-4-12;7-5(8)3-1-2-4-6(9)10/h1-12H2;1-4H2,(H,7,8)(H,9,10) |
| Molecular Formula | C16H34N4O4 |
| Molecular Weight | 346.4656 |
| Boiling point | 334.5°C at 760 mmHg |
| Flash point | 162.8°C |
5423-61-0 adipic acid, compound with 1,4-bis(3-aminopropyl)piperazine (1:1)
service@apichina.com