| Product Name | adamantane-1-carbohydrazide |
| CAS No. | 17846-15-0 |
| Synonyms | tricyclo[3.3.1.1~3,7~]decane-1-carbohydrazide |
| InChI | InChI=1/C11H18N2O/c12-13-10(14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6,12H2,(H,13,14) |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.2734 |
| Density | 1.203g/cm3 |
| Melting point | 157℃ |
| Boiling point | 370.8°C at 760 mmHg |
| Flash point | 178°C |
| Refractive index | 1.581 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
17846-15-0 adamantane-1-carbohydrazide
service@apichina.com