| Product Name | Acryloyl chloride |
| CAS No. | 814-68-6 |
| Synonyms | Propenoyl chloride; Acrylyl chloride; prop-2-enoyl chloride; Acyloyl chloride |
| InChI | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
| Molecular Formula | C3H3OCl |
| Molecular Weight | 90.5083 |
| Density | 1.108g/cm3 |
| Boiling point | 75.5°C at 760 mmHg |
| Flash point | 16.1°C |
| Refractive index | 1.417 |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S30:Never add water to this product.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
814-68-6 acryloyl chloride
service@apichina.com