| Product Name | Acriflavine hydrochloride |
| CAS No. | 8063-24-9 |
| Synonyms | Acriflavine HCl; 3,6-diamino-10-methylacridinium chloride - acridine-3,6-diamine hydrochloride (1:1:1:2); 3,6-diamino-10-methylacridinium chloride - acridine-3,6-diamine (1:1) hydrochloride |
| InChI | InChI=1/C14H13N3.C13H11N3.2ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;;/h2-8H,1H3,(H3,15,16);1-7H,14-15H2;2*1H |
| Molecular Formula | C27H26Cl2N6 |
| Molecular Weight | 505.4415 |
| Melting point | 260℃ |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R45:May cause cancer.; R46:May cause heritable genetic damages.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
8063-24-9 acriflavine hydrochloride
service@apichina.com