| Product Name | Acridine |
| CAS No. | 260-94-6 |
| Synonyms | Dibenzo[b,e]pyridine |
| InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.2173 |
| Density | 1.187g/cm3 |
| Melting point | 105-110℃ |
| Boiling point | 346.7°C at 760 mmHg |
| Flash point | 153.8°C |
| Refractive index | 1.726 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
260-94-6 acridine
service@apichina.com