| Product Name | Acetyl-d3 chloride |
| CAS No. | 19259-90-6 |
| Synonyms | (2H3)Acetyl chloride; (~2~H_3_)acetyl chloride |
| InChI | InChI=1/C2H3ClO/c1-2(3)4/h1H3/i1D3 |
| Molecular Formula | C2D3ClO |
| Molecular Weight | 81.5161 |
| Density | 1.163g/cm3 |
| Boiling point | 46°C at 760 mmHg |
| Flash point | 4.4°C |
| Refractive index | 1.379 |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R14:Reacts violently with water.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S9:Keep container in a well-ventilated place.; |
19259-90-6 acetyl-d3 chloride
service@apichina.com