| Product Name | Acetophenone Azine |
| CAS No. | 729-43-1 |
| Synonyms | Ethanone, 1-phenyl-, 2-(1-phenylethylidene)hydrazone; Acetophenone azine; Ethanone, 1-phenyl-, (1-phenylethylidene)hydrazone; NSC 25772; 1-Phenylethan-1-one (1-phenylethylidene)hydrazone; Acetophenone, azine (8CI); bis(1-phenylethylidene)hydrazine; (1Z,2Z)-bis(1-phenylethylidene)hydrazine; (1E,2E)-bis(1-phenylethylidene)hydrazine |
| InChI | InChI=1/C16H16N2/c1-13(15-9-5-3-6-10-15)17-18-14(2)16-11-7-4-8-12-16/h3-12H,1-2H3/b17-13+,18-14+ |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.3116 |
| Density | 0.98g/cm3 |
| Boiling point | 333.2°C at 760 mmHg |
| Flash point | 147.4°C |
| Refractive index | 1.551 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
729-43-1 acetophenone azine
service@apichina.com