| Product Name | acetone thiosemicarbazone |
| CAS No. | 1752-30-3 |
| Synonyms | ATSC; propan-2-one thiosemicarbazone; Acetorme thios emicarbazone |
| InChI | InChI=1/C4H9N3S/c1-3(2)6-7-4(5)8/h1-2H3,(H3,5,7,8) |
| Molecular Formula | C4H9N3S |
| Molecular Weight | 131.1994 |
| Density | 1.19g/cm3 |
| Boiling point | 213.8°C at 760 mmHg |
| Flash point | 83.1°C |
| Refractive index | 1.569 |
| Risk Codes | R21:Harmful in contact with skin.; R25:Toxic if swallowed.; R26:Very toxic by inhalation.; |
| Safety | S22:Do not inhale dust.; S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1752-30-3 acetone thiosemicarbazone
service@apichina.com