| Product Name | Acetoacetic Acid |
| CAS No. | 541-50-4 |
| Synonyms | 3-Oxobutanoic acid |
| InChI | InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.0886 |
| Density | 1.182g/cm3 |
| Boiling point | 237.7°C at 760 mmHg |
| Flash point | 111.8°C |
| Refractive index | 1.427 |
| Risk Codes | R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
541-50-4 acetoacetic acid
service@apichina.com