| Product Name | Acetic-d3 acid-d |
| CAS No. | 1186-52-3 |
| InChI | InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| Molecular Formula | C2D4O2 |
| Molecular Weight | 64.0766 |
| Density | 1.14g/cm3 |
| Melting point | 15-16℃ |
| Boiling point | 117.1°C at 760 mmHg |
| Flash point | 40°C |
| Refractive index | 1.375 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R10:Flammable.; R35:Causes severe burns.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1186-52-3 acetic-d3 acid-d
service@apichina.com