| Product Name | (Acetic anhydride)-d6 |
| CAS No. | 16649-49-3 |
| Synonyms | (2H3)Acetic anhydride; (~2~H_3_)ethanoic anhydride |
| InChI | InChI=1/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1D3,2D3 |
| Molecular Formula | C4D6O3 |
| Molecular Weight | 108.1256 |
| Density | 1.136g/cm3 |
| Boiling point | 141.1°C at 760 mmHg |
| Flash point | 54.4°C |
| Refractive index | 1.386 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R10:Flammable.; R20/22:Harmful by inhalation and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
16649-49-3 (acetic anhydride)-d6
service@apichina.com