| Product Name | Acetic acid-d |
| CAS No. | 758-12-3 |
| Synonyms | Acetic acid-d1; acetate; (O-~2~H)acetic acid |
| InChI | InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
| Molecular Formula | C2H3DO2 |
| Molecular Weight | 61.0581 |
| Density | 1.086g/cm3 |
| Melting point | 15-16℃ |
| Boiling point | 117.1°C at 760 mmHg |
| Flash point | 40°C |
| Refractive index | 1.375 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R10:Flammable.; R35:Causes severe burns.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
758-12-3 acetic acid-d
service@apichina.com