| Product Name | Acetaldehyde ammonia trimer |
| CAS No. | 75-39-8 |
| Synonyms | Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
| InChI | InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
| Molecular Formula | C2H7NO |
| Molecular Weight | 61.0831 |
| Density | 0.967g/cm3 |
| Melting point | 95-97℃ |
| Boiling point | 113.8°C at 760 mmHg |
| Flash point | 22.7°C |
| Refractive index | 1.431 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
75-39-8 acetaldehyde ammonia trimer
service@apichina.com
- Next:75-43-4 dichlorofluoromethane
- Previous:75-38-7 vinylidene fluoride