| Product Name | A mixture of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate and isobutyl hydrogen 2-(β-2,4,6-trimethylnon-2-enyl)succinate |
| CAS No. | 141847-13-4 |
| Synonyms | Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester; Butanedioic acid, dodecenyl-, mono(2-methylpropyl) ester; (8E)-2-[2-(2-methylpropoxy)-2-oxoethyl]tetradec-8-enoic acid |
| InChI | InChI=1/C20H36O4/c1-4-5-6-7-8-9-10-11-12-13-14-18(20(22)23)15-19(21)24-16-17(2)3/h8-9,17-18H,4-7,10-16H2,1-3H3,(H,22,23)/b9-8+ |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.4974 |
| Density | 0.969g/cm3 |
| Boiling point | 458.7°C at 760 mmHg |
| Flash point | 148.8°C |
| Refractive index | 1.47 |
141847-13-4 a mixture of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate and isobu
service@apichina.com