| Product Name | A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate |
| CAS No. | 80657-64-3 |
| Synonyms | 4,7-Methano-3aH-indene-3a-carboxylic acid, octahydro-, ethyl ester, (3aalpha,4alpha,7alpha,7aalpha)-; Ethyl hexahydro-4,7-methanoindane-3a-carboxylate; ethyl (3aR,4S,7R,7aR)-octahydro-3aH-4,7-methanoindene-3a-carboxylate |
| InChI | InChI=1/C13H20O2/c1-2-15-12(14)13-7-3-4-11(13)9-5-6-10(13)8-9/h9-11H,2-8H2,1H3/t9-,10+,11-,13-/m1/s1 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.2967 |
| Density | 1.106g/cm3 |
| Boiling point | 261.8°C at 760 mmHg |
| Flash point | 109.9°C |
| Refractive index | 1.524 |
80657-64-3 a mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-
service@apichina.com