| Product Name | 9-Octadecenoic acid (Z)-, reaction products with 2-[(2-aminoethyl)amino]ethanol and methyl acrylate, saponified |
| CAS No. | 70024-80-5 |
| Synonyms | 9-Octadecenoic acid (9Z)-, reaction products with 2-((2-aminoethyl)amino)ethanol and methyl acrylate, saponified; 9-Octadecenoic acid (Z)-, reaction products with 2-((2-aminoethyl)amino)ethanol and methyl acrylate, saponified; 2-(2-aminoethylamino)ethanol: methyl prop-2-enoate: (Z)-octadec-9-enoic acid |
| InChI | InChI=1/C18H34O2.C4H12N2O.C4H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7;1-3-4(5)6-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);6-7H,1-5H2;3H,1H2,2H3/b10-9-;; |
| Molecular Formula | C26H52N2O5 |
| Molecular Weight | 472.7015 |
| Boiling point | 360°C at 760 mmHg |
| Flash point | 270.1°C |
70024-80-5 9-octadecenoic acid (z)-, reaction products with 2-[(2-aminoethyl)amino]ethanol and methy
service@apichina.com