| Product Name | 9-Octadecenoic acid (Z)-, mixed esters with diethylene glycol and glycerol |
| CAS No. | 68511-89-7 |
| Synonyms | 9-Octadecenoic acid (9Z)-, mixed esters with diethylene glycol and glycerol; glycerol,2-(2-hydroxyethoxy)ethanol,(Z)-octadec-9-enoic acid |
| InChI | InChI=1/C18H34O2.C4H10O3.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;4-1-3(6)2-5/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6H,1-4H2;3-6H,1-2H2/b10-9-;; |
| Molecular Formula | C25H52O8 |
| Molecular Weight | 480.6756 |
| Boiling point | 360°C at 760 mmHg |
| Flash point | 270.1°C |
68511-89-7 9-octadecenoic acid (z)-, mixed esters with diethylene glycol and glycerol
service@apichina.com