| Product Name | 9-Methyl-2,3,7-trihydroxy-6-fluorone sulfate |
| CAS No. | 5407-46-5 |
| Synonyms | 2,6,7-trihydroxy-9-methylxanthen-3-one; 9-Methyl-2,3,7-trihydroxy-6-fluorone sulphate; 2,6,7-trihydroxy-9-methyl-3H-xanthen-3-one |
| InChI | InChI=1/C14H10O5/c1-6-7-2-9(15)11(17)4-13(7)19-14-5-12(18)10(16)3-8(6)14/h2-5,15-17H,1H3 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.2262 |
| Density | 1.63g/cm3 |
| Boiling point | 610.5°C at 760 mmHg |
| Flash point | 241.6°C |
| Refractive index | 1.761 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5407-46-5 9-methyl-2,3,7-trihydroxy-6-fluorone sulfate
service@apichina.com