| Product Name | 9-Fluorenone hydrazone |
| CAS No. | 13629-22-6 |
| Synonyms | Fluorenone hydrazone; 9H-Fluoren-9-one hydrazone; 9H-fluoren-9-ylidenehydrazine |
| InChI | InChI=1/C13H10N2/c14-15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H,14H2 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.2319 |
| Density | 1.23g/cm3 |
| Melting point | 149-150℃ |
| Boiling point | 362.5°C at 760 mmHg |
| Flash point | 173°C |
| Refractive index | 1.682 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13629-22-6 9-fluorenone hydrazone
service@apichina.com