| Product Name | 9-Cyanophenanthrene |
| CAS No. | 2510-55-6 |
| Synonyms | Cyanophenanthrene; phenanthrene-9-carbonitrile |
| InChI | InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
| Molecular Formula | C15H9N |
| Molecular Weight | 203.2387 |
| Density | 1.2g/cm3 |
| Melting point | 110-112℃ |
| Boiling point | 413.8°C at 760 mmHg |
| Flash point | 205.4°C |
| Refractive index | 1.719 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
2510-55-6 9-cyanophenanthrene
service@apichina.com