| Product Name | 9-Chlorophenanthrene |
| CAS No. | 947-72-8 |
| Synonyms | Phenanthrene, 9-chloro-; 10-Chlorophenanthrene; 4-05-00-02303 (Beilstein Handbook Reference); AI3-24095; BRN 2047058; CCRIS 5543; NSC 8552 |
| InChI | InChI=1/C14H9Cl/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| Molecular Formula | C14H9Cl |
| Molecular Weight | 212.6743 |
| Density | 1.253g/cm3 |
| Melting point | 46-50℃ |
| Boiling point | 370.1°C at 760 mmHg |
| Flash point | 179.2°C |
| Refractive index | 1.717 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
947-72-8 9-chlorophenanthrene
service@apichina.com