| Product Name | 9-chloroanthracene |
| CAS No. | 716-53-0 |
| Synonyms | Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
| InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| Molecular Formula | C14H9Cl |
| Molecular Weight | 212.6743 |
| Density | 1.253g/cm3 |
| Melting point | 103-103℃ |
| Boiling point | 370.1°C at 760 mmHg |
| Flash point | 179.2°C |
| Refractive index | 1.717 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
716-53-0 9-chloroanthracene
service@apichina.com