| Product Name | 9-chloro-5-methyl-5H-benzo[5,6]thiino[4,3-d]pyrimidin-2-amine |
| CAS No. | 254429-65-7 |
| Synonyms | 9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine |
| InChI | InChI=1/C12H10ClN3S/c1-6-9-5-15-12(14)16-11(9)8-4-7(13)2-3-10(8)17-6/h2-6H,1H3,(H2,14,15,16) |
| Molecular Formula | C12H10ClN3S |
| Molecular Weight | 263.7459 |
| Density | 1.416g/cm3 |
| Melting point | 181℃ |
| Boiling point | 534.3°C at 760 mmHg |
| Flash point | 277°C |
| Refractive index | 1.7 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
254429-65-7 9-chloro-5-methyl-5h-benzo[5,6]thiino[4,3-d]pyrimidin-2-amine
service@apichina.com