| Product Name | 8-Phenyloctanoic acid |
| CAS No. | 26547-51-3 |
| Synonyms | 8-phenyloctanoate; 8-Phenyl-1-octanoic acid |
| InChI | InChI=1/C14H20O2/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16)/p-1 |
| Molecular Formula | C14H19O2 |
| Molecular Weight | 219.3 |
| Boiling point | 369.9°C at 760 mmHg |
| Flash point | 266.9°C |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
26547-51-3 8-phenyloctanoic acid
service@apichina.com