| Product Name | 8-Nitroquinaldine |
| CAS No. | 881-07-2 |
| Synonyms | Nitroquinaldine; 2-Methyl-8-nitroquinoline |
| InChI | InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.1827 |
| Density | 1.298g/cm3 |
| Boiling point | 323.8°C at 760 mmHg |
| Flash point | 149.6°C |
| Refractive index | 1.661 |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
881-07-2 8-nitroquinaldine
service@apichina.com