| Product Name | 8-Hydroxy-7-methoxycoumarin |
| CAS No. | 19492-03-6 |
| Synonyms | Daphnetin 7-methyl ether; 8-hydroxy-7-methoxy-2H-chromen-2-one |
| InChI | InChI=1/C10H8O4/c1-13-7-4-2-6-3-5-8(11)14-10(6)9(7)12/h2-5,12H,1H3 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.1681 |
| Density | 1.377g/cm3 |
| Boiling point | 381.9°C at 760 mmHg |
| Flash point | 158.3°C |
| Refractive index | 1.609 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
19492-03-6 8-hydroxy-7-methoxycoumarin
service@apichina.com